CAS 1932353-80-4 is the registry number for (1S,2S)-2-Hydroxycyclopentane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1S,2S)-2-hydroxycyclopentane-1-carboxylic acid (CAS 1932353-80-4) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: trans-(1S,2S)-2-hydroxycyclopentane-1-carboxylic acid. InChIKey: VCHGSWURBGPKQZ-WHFBIAKZSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | trans-(1S,2S)-2-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | VCHGSWURBGPKQZ-WHFBIAKZSA-N |
| SMILES | C1C[C@@H]([C@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)