CAS 1250773-62-6 appears in our catalog under these names: 2,2-Difluoro-2-(2-methoxyphenyl)acetic acid, 95%, Difluoro(2-methoxyphenyl)acetic acid, 95-<97%, 2,2-Difluoro-2-(2-methoxyphenyl)acetic acid, 98%, 2,2–difluoro–2–(2–methoxyphenyl)acetic acid, 2,2-Difluoro-2-(2-methoxyphenyl)acetic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 50g, 0,5g.
2,2-difluoro-2-(2-methoxyphenyl)acetic acid (CAS 1250773-62-6) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,2-difluoro-2-(2-methoxyphenyl)acetic acid. InChIKey: ULFXSWWASZBBPE-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2,2-difluoro-2-(2-methoxyphenyl)acetic acid |
| InChIKey | ULFXSWWASZBBPE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(C(=O)O)(F)F |
Computed by PubChem (NCBI)