Products 1250842-68-2

CAS 1250842-68-2 is the registry number for 3-(4-Iodobenzamido)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(4-iodobenzoyl)amino]-2-methylpropanoic acid (CAS 1250842-68-2) is a chemical compound with the molecular formula C11H12INO3 and a molecular weight of 333.12 g/mol. IUPAC name: 3-[(4-iodobenzoyl)amino]-2-methylpropanoic acid. InChIKey: ALTCPMQUMYGLRT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12INO3
Molecular weight333.12 g/mol
IUPAC name3-[(4-iodobenzoyl)amino]-2-methylpropanoic acid
InChIKeyALTCPMQUMYGLRT-UHFFFAOYSA-N
SMILESCC(CNC(=O)C1=CC=C(C=C1)I)C(=O)O

Computed by PubChem (NCBI)