Products 1604308-75-9
CAS 1604308-75-9 appears in our catalog under these names: (2R)-2-((2-Iodo-3-methylphenyl)formamido)propanoic acid, 95%, (2R)-2-((2-Iodo-3-methylphenyl)formamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
(2R)-2-[(2-iodo-3-methylbenzoyl)amino]propanoic acid (CAS 1604308-75-9) is a chemical compound with the molecular formula C11H12INO3 and a molecular weight of 333.12 g/mol. IUPAC name: (2R)-2-[(2-iodo-3-methylbenzoyl)amino]propanoic acid. InChIKey: XMJFHZGKUSUCCG-SSDOTTSWSA-N.
| Molecular formula | C11H12INO3 |
|---|---|
| Molecular weight | 333.12 g/mol |
| IUPAC name | (2R)-2-[(2-iodo-3-methylbenzoyl)amino]propanoic acid |
| InChIKey | XMJFHZGKUSUCCG-SSDOTTSWSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)N[C@H](C)C(=O)O)I |
Computed by PubChem (NCBI)