CAS 457615-88-2 appears in our catalog under these names: (Rs)-ac-2-amino-3-(4-iodophenyl)propionic acid, 98%, Acetyl-4-iodo-DL-phenylalanine, 97%, N-Acetyl-4-iodo-DL-phenylalanine, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g.
2-acetamido-3-(4-iodophenyl)propanoic acid (CAS 457615-88-2) is a chemical compound with the molecular formula C11H12INO3 and a molecular weight of 333.12 g/mol. IUPAC name: 2-acetamido-3-(4-iodophenyl)propanoic acid. InChIKey: RTVNNJWKXVLALU-UHFFFAOYSA-N.
| Molecular formula | C11H12INO3 |
|---|---|
| Molecular weight | 333.12 g/mol |
| IUPAC name | 2-acetamido-3-(4-iodophenyl)propanoic acid |
| InChIKey | RTVNNJWKXVLALU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC=C(C=C1)I)C(=O)O |
Computed by PubChem (NCBI)