CAS 2721373-58-4 is the registry number for Methyl 4-amino-3-cyclopropoxy-5-iodobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-amino-3-cyclopropyloxy-5-iodobenzoate (CAS 2721373-58-4) is a chemical compound with the molecular formula C11H12INO3 and a molecular weight of 333.12 g/mol. IUPAC name: methyl 4-amino-3-cyclopropyloxy-5-iodobenzoate. InChIKey: GMLQGOKXSIXLKQ-UHFFFAOYSA-N.
| Molecular formula | C11H12INO3 |
|---|---|
| Molecular weight | 333.12 g/mol |
| IUPAC name | methyl 4-amino-3-cyclopropyloxy-5-iodobenzoate |
| InChIKey | GMLQGOKXSIXLKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)I)N)OC2CC2 |
Computed by PubChem (NCBI)