CAS 1250994-80-9 is the registry number for (1R,6S)-Rel-3-boc-6-methyl-3,8-diazabicyclo[4.2.0]octane, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
Tert-butyl (1R,6S)-6-methyl-3,8-diazabicyclo[4.2.0]octane-3-carboxylate (CAS 1250994-80-9) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (1R,6S)-6-methyl-3,8-diazabicyclo[4.2.0]octane-3-carboxylate. InChIKey: PXSDUVHLZMOBDQ-CABZTGNLSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (1R,6S)-6-methyl-3,8-diazabicyclo[4.2.0]octane-3-carboxylate |
| InChIKey | PXSDUVHLZMOBDQ-CABZTGNLSA-N |
| SMILES | C[C@@]12CCN(C[C@@H]1NC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)