CAS 1251012-16-4 is the registry number for tert-Butyl 5-bromo-3,4-dihydro-2,7-naphthyridine-2(1H)-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,05g, 0,1g, 0,25g, 1g.
Tert-butyl 5-bromo-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (CAS 1251012-16-4) is a chemical compound with the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. IUPAC name: tert-butyl 5-bromo-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate. InChIKey: OGYWVPPKWOROPY-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O2 |
|---|---|
| Molecular weight | 313.19 g/mol |
| IUPAC name | tert-butyl 5-bromo-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| InChIKey | OGYWVPPKWOROPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C=NC=C2C1)Br |
Computed by PubChem (NCBI)