Products 1251013-63-4
CAS 1251013-63-4 is the registry number for 3-Bromo-2-(piperidin-3-yl)imidazo[1,2-a]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-piperidin-3-ylimidazo[1,2-a]pyridine (CAS 1251013-63-4) is a chemical compound with the molecular formula C12H14BrN3 and a molecular weight of 280.16 g/mol. IUPAC name: 3-bromo-2-piperidin-3-ylimidazo[1,2-a]pyridine. InChIKey: UGVHGCGLZUDYCL-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3 |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 3-bromo-2-piperidin-3-ylimidazo[1,2-a]pyridine |
| InChIKey | UGVHGCGLZUDYCL-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=C(N3C=CC=CC3=N2)Br |
Computed by PubChem (NCBI)