CAS 2287311-93-5 is the registry number for 6-Bromo-1-(3,3-dimethylcyclobutyl)-1H-benzo[d][1,2,3]triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-1-(3,3-dimethylcyclobutyl)benzotriazole (CAS 2287311-93-5) is a chemical compound with the molecular formula C12H14BrN3 and a molecular weight of 280.16 g/mol. IUPAC name: 6-bromo-1-(3,3-dimethylcyclobutyl)benzotriazole. InChIKey: BBWDIHYSRCQVLC-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3 |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 6-bromo-1-(3,3-dimethylcyclobutyl)benzotriazole |
| InChIKey | BBWDIHYSRCQVLC-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)N2C3=C(C=CC(=C3)Br)N=N2)C |
Computed by PubChem (NCBI)