Products 1784790-09-5
CAS 1784790-09-5 is the registry number for 5-Bromo-3-methyl-1-(pyrrolidin-3-yl)-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-methyl-1-pyrrolidin-3-ylindazole (CAS 1784790-09-5) is a chemical compound with the molecular formula C12H14BrN3 and a molecular weight of 280.16 g/mol. IUPAC name: 5-bromo-3-methyl-1-pyrrolidin-3-ylindazole. InChIKey: UDJQPSMOQJFOEB-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3 |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 5-bromo-3-methyl-1-pyrrolidin-3-ylindazole |
| InChIKey | UDJQPSMOQJFOEB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=C2)Br)C3CCNC3 |
Computed by PubChem (NCBI)