Products 956197-87-8
CAS 956197-87-8 appears in our catalog under these names: 4-Bromo-1-(3,5-dimethylphenyl)-3-methyl-1h-pyrazol-5-amine, 95%, 4-Bromo-1-(3,5-dimethylphenyl)-3-methyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
4-bromo-1-(3,5-dimethylphenyl)-3-methylpyrazol-5-amine (CAS 956197-87-8) is a chemical compound with the molecular formula C12H14BrN3 and a molecular weight of 280.16 g/mol. IUPAC name: 4-bromo-1-(3,5-dimethylphenyl)-3-methylpyrazol-5-amine. InChIKey: AFDNSXLLALOQBQ-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3 |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 4-bromo-1-(3,5-dimethylphenyl)-3-methylpyrazol-5-amine |
| InChIKey | AFDNSXLLALOQBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C(=C(C(=N2)C)Br)N)C |
Computed by PubChem (NCBI)