Products 125106-41-4
CAS 125106-41-4 is the registry number for 4-(Ethanesulfonyl)benzene-1,2-diamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-ethylsulfonylbenzene-1,2-diamine (CAS 125106-41-4) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 4-ethylsulfonylbenzene-1,2-diamine. InChIKey: JRCUHLAJCDQEAS-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-ethylsulfonylbenzene-1,2-diamine |
| InChIKey | JRCUHLAJCDQEAS-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)