CAS 1251238-17-1 is the registry number for 1-(2,3,4-Trifluorophenyl)guanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3,4-trifluorophenyl)guanidine (CAS 1251238-17-1) is a chemical compound with the molecular formula C7H6F3N3 and a molecular weight of 189.14 g/mol. IUPAC name: 2-(2,3,4-trifluorophenyl)guanidine. InChIKey: BKINSITVUMPGMC-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3 |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | 2-(2,3,4-trifluorophenyl)guanidine |
| InChIKey | BKINSITVUMPGMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N=C(N)N)F)F)F |
Computed by PubChem (NCBI)