CAS 1260659-29-7 is the registry number for (1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]acetonitrile (CAS 1260659-29-7) is a chemical compound with the molecular formula C7H6F3N3 and a molecular weight of 189.14 g/mol. IUPAC name: 2-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]acetonitrile. InChIKey: UGAGCTBWKKFXKH-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3 |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | 2-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]acetonitrile |
| InChIKey | UGAGCTBWKKFXKH-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)CC#N)C(F)(F)F |
Computed by PubChem (NCBI)