CAS 1251923-15-5 appears in our catalog under these names: 2-(1-(2,2,2-Trifluoroethyl)-1H-imidazol-2-yl)acetonitrile, 95%, 2-(1-(2,2,2-Trifluoroethyl)-1H-imidazol-2-yl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[1-(2,2,2-trifluoroethyl)imidazol-2-yl]acetonitrile (CAS 1251923-15-5) is a chemical compound with the molecular formula C7H6F3N3 and a molecular weight of 189.14 g/mol. IUPAC name: 2-[1-(2,2,2-trifluoroethyl)imidazol-2-yl]acetonitrile. InChIKey: WWHCIFNAXSSZJE-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3 |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | 2-[1-(2,2,2-trifluoroethyl)imidazol-2-yl]acetonitrile |
| InChIKey | WWHCIFNAXSSZJE-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)CC#N)CC(F)(F)F |
Computed by PubChem (NCBI)