Products 905274-04-6
CAS 905274-04-6 is the registry number for 2–(Trifluoromethyl)–6，7–dihydro–5h–pyrrolo(3，4–d)pyrimidine. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
2-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (CAS 905274-04-6) is a chemical compound with the molecular formula C7H6F3N3 and a molecular weight of 189.14 g/mol. IUPAC name: 2-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine. InChIKey: WAXINHRGKZWFCJ-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3 |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| InChIKey | WAXINHRGKZWFCJ-UHFFFAOYSA-N |
| SMILES | C1C2=CN=C(N=C2CN1)C(F)(F)F |
Computed by PubChem (NCBI)