CAS 1251321-78-4 appears in our catalog under these names: 5-(Chloromethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole, 95%, 5-(Chloromethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(chloromethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole (CAS 1251321-78-4) is a chemical compound with the molecular formula C9H4ClF3N2O and a molecular weight of 248.59 g/mol. IUPAC name: 5-(chloromethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole. InChIKey: XUNPLDOMUGQLBV-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3N2O |
|---|---|
| Molecular weight | 248.59 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole |
| InChIKey | XUNPLDOMUGQLBV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)