Products 53313-05-6

CAS 53313-05-6 is the registry number for N-(3-chloro-4-cyanophenyl)-2,2,2-trifluoroacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

N-(3-chloro-4-cyanophenyl)-2,2,2-trifluoroacetamide (CAS 53313-05-6) is a chemical compound with the molecular formula C9H4ClF3N2O and a molecular weight of 248.59 g/mol. IUPAC name: N-(3-chloro-4-cyanophenyl)-2,2,2-trifluoroacetamide. InChIKey: GDJOBHDTKRLDEA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4ClF3N2O
Molecular weight248.59 g/mol
IUPAC nameN-(3-chloro-4-cyanophenyl)-2,2,2-trifluoroacetamide
InChIKeyGDJOBHDTKRLDEA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1NC(=O)C(F)(F)F)Cl)C#N

Computed by PubChem (NCBI)