Products 2568130-88-9
CAS 2568130-88-9 is the registry number for 7,7'-DICHLORO-2,2'-BITHIENO[3,2-B]PYRIDINE, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-chloro-4-[5-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole (CAS 2568130-88-9) is a chemical compound with the molecular formula C9H4ClF3N2O and a molecular weight of 248.59 g/mol. IUPAC name: 2-chloro-4-[5-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole. InChIKey: HJNMPWGMPRNKQK-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3N2O |
|---|---|
| Molecular weight | 248.59 g/mol |
| IUPAC name | 2-chloro-4-[5-(trifluoromethyl)-2-pyridinyl]-1,3-oxazole |
| InChIKey | HJNMPWGMPRNKQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)C2=COC(=N2)Cl |
Computed by PubChem (NCBI)