CAS 246022-17-3 is the registry number for 3-Chloro-2-(4-isoxazolyl)-5-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,2-oxazole (CAS 246022-17-3) is a chemical compound with the molecular formula C9H4ClF3N2O and a molecular weight of 248.59 g/mol. IUPAC name: 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,2-oxazole. InChIKey: GYYNWOFIORAVAD-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3N2O |
|---|---|
| Molecular weight | 248.59 g/mol |
| IUPAC name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,2-oxazole |
| InChIKey | GYYNWOFIORAVAD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C2=CON=C2)C(F)(F)F |
Computed by PubChem (NCBI)