CAS 1251388-17-6 is the registry number for 2-Fluoro-N-(thiazol-4-ylmethyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-N-(1,3-thiazol-4-ylmethyl)aniline (CAS 1251388-17-6) is a chemical compound with the molecular formula C10H9FN2S and a molecular weight of 208.26 g/mol. IUPAC name: 2-fluoro-N-(1,3-thiazol-4-ylmethyl)aniline. InChIKey: NFNJBEZWCWCGAS-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2S |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-fluoro-N-(1,3-thiazol-4-ylmethyl)aniline |
| InChIKey | NFNJBEZWCWCGAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCC2=CSC=N2)F |
Computed by PubChem (NCBI)