CAS 643723-43-7 is the registry number for 1-[4-(4-Fluorophenyl)-1,3-thiazol-2-yl]methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methanamine (CAS 643723-43-7) is a chemical compound with the molecular formula C10H9FN2S and a molecular weight of 208.26 g/mol. IUPAC name: [4-(4-fluorophenyl)-1,3-thiazol-2-yl]methanamine. InChIKey: DVIOACKZHUPVGY-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2S |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | [4-(4-fluorophenyl)-1,3-thiazol-2-yl]methanamine |
| InChIKey | DVIOACKZHUPVGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)CN)F |
Computed by PubChem (NCBI)