CAS 3830-48-6 appears in our catalog under these names: 2-Amino-4-(4'-fluoro-3'-methyl)phenylthiazole, 95%, 2–Amino–4–(4'–fluoro–3'–methyl)phenylthiazole, 2-Amino-4-(4'-fluoro-3'-methyl)phenylthiazole, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 25g, 5g.
4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-amine (CAS 3830-48-6) is a chemical compound with the molecular formula C10H9FN2S and a molecular weight of 208.26 g/mol. IUPAC name: 4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-amine. InChIKey: XJPFIMKKTVFXIN-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2S |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | XJPFIMKKTVFXIN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CSC(=N2)N)F |
Computed by PubChem (NCBI)