CAS 876715-72-9 is the registry number for 5-(2-Fluorobenzyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-amine (CAS 876715-72-9) is a chemical compound with the molecular formula C10H9FN2S and a molecular weight of 208.26 g/mol. IUPAC name: 5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: MJWGGQHOCHEUHY-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2S |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | MJWGGQHOCHEUHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=CN=C(S2)N)F |
Computed by PubChem (NCBI)