CAS 1251914-00-7 is the registry number for 2-Methoxy-6-(2,4,6-trifluorophenyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-6-(2,4,6-trifluorophenyl)pyridine (CAS 1251914-00-7) is a chemical compound with the molecular formula C12H8F3NO and a molecular weight of 239.19 g/mol. IUPAC name: 2-methoxy-6-(2,4,6-trifluorophenyl)pyridine. InChIKey: RZVWLHDBIJYBBX-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO |
|---|---|
| Molecular weight | 239.19 g/mol |
| IUPAC name | 2-methoxy-6-(2,4,6-trifluorophenyl)pyridine |
| InChIKey | RZVWLHDBIJYBBX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=N1)C2=C(C=C(C=C2F)F)F |
Computed by PubChem (NCBI)