CAS 557796-53-9 is the registry number for Rel-(1R,2R)-1-benzoyl-2-(trifluoromethyl)cyclopropane-1-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-1-benzoyl-2-(trifluoromethyl)cyclopropane-1-carbonitrile (CAS 557796-53-9) is a chemical compound with the molecular formula C12H8F3NO and a molecular weight of 239.19 g/mol. IUPAC name: trans-(1R,2R)-1-benzoyl-2-(trifluoromethyl)cyclopropane-1-carbonitrile. InChIKey: RORYYELCLNOLHG-KOLCDFICSA-N.
| Molecular formula | C12H8F3NO |
|---|---|
| Molecular weight | 239.19 g/mol |
| IUPAC name | trans-(1R,2R)-1-benzoyl-2-(trifluoromethyl)cyclopropane-1-carbonitrile |
| InChIKey | RORYYELCLNOLHG-KOLCDFICSA-N |
| SMILES | C1[C@H]([C@]1(C#N)C(=O)C2=CC=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)