CAS 549547-31-1 is the registry number for 4-(4-Fluorophenoxy)-3,5-difluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3,5-difluoro-4-(4-fluorophenoxy)aniline (CAS 549547-31-1) is a chemical compound with the molecular formula C12H8F3NO and a molecular weight of 239.19 g/mol. IUPAC name: 3,5-difluoro-4-(4-fluorophenoxy)aniline. InChIKey: ZSMNCJYXFNBIOD-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO |
|---|---|
| Molecular weight | 239.19 g/mol |
| IUPAC name | 3,5-difluoro-4-(4-fluorophenoxy)aniline |
| InChIKey | ZSMNCJYXFNBIOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2F)N)F)F |
Computed by PubChem (NCBI)