CAS 156496-70-7 is the registry number for 1-[4-(Trifluoromethyl)phenyl]-1h-pyrrole-2-carbaldehyde, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1-[4-(trifluoromethyl)phenyl]pyrrole-2-carbaldehyde (CAS 156496-70-7) is a chemical compound with the molecular formula C12H8F3NO and a molecular weight of 239.19 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]pyrrole-2-carbaldehyde. InChIKey: FGKJQSVGKXECDA-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO |
|---|---|
| Molecular weight | 239.19 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]pyrrole-2-carbaldehyde |
| InChIKey | FGKJQSVGKXECDA-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)