CAS 1251924-24-9 is the registry number for (2-Bromo-4,5-dimethoxyphenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1000mg.
(2-bromo-4,5-dimethoxyphenyl)methanamine;hydrochloride (CAS 1251924-24-9) is a chemical compound with the molecular formula C9H13BrClNO2 and a molecular weight of 282.56 g/mol. IUPAC name: (2-bromo-4,5-dimethoxyphenyl)methanamine;hydrochloride. InChIKey: YTUGVGNECAARQQ-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO2 |
|---|---|
| Molecular weight | 282.56 g/mol |
| IUPAC name | (2-bromo-4,5-dimethoxyphenyl)methanamine;hydrochloride |
| InChIKey | YTUGVGNECAARQQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CN)Br)OC.Cl |
Computed by PubChem (NCBI)