CAS 1251924-36-3 appears in our catalog under these names: 2-Chloro-N-(5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl)acetamide, 95%, 2-Chloro-N-(5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-N-[5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl]acetamide (CAS 1251924-36-3) is a chemical compound with the molecular formula C9H8ClN3O2S and a molecular weight of 257.70 g/mol. IUPAC name: 2-chloro-N-[5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl]acetamide. InChIKey: QDGYQFNQSAAFPF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2S |
|---|---|
| Molecular weight | 257.70 g/mol |
| IUPAC name | 2-chloro-N-[5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl]acetamide |
| InChIKey | QDGYQFNQSAAFPF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C2=NN=C(O2)NC(=O)CCl |
Computed by PubChem (NCBI)