CAS 2287317-66-0 is the registry number for 3-(6-Chloro-1H-benzo[d][1,2,3]triazol-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-chlorobenzotriazol-1-yl)thietane 1,1-dioxide (CAS 2287317-66-0) is a chemical compound with the molecular formula C9H8ClN3O2S and a molecular weight of 257.70 g/mol. IUPAC name: 3-(6-chlorobenzotriazol-1-yl)thietane 1,1-dioxide. InChIKey: VPCCKSOGGOEKOS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2S |
|---|---|
| Molecular weight | 257.70 g/mol |
| IUPAC name | 3-(6-chlorobenzotriazol-1-yl)thietane 1,1-dioxide |
| InChIKey | VPCCKSOGGOEKOS-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)N2C3=C(C=CC(=C3)Cl)N=N2 |
Computed by PubChem (NCBI)