Products 208994-00-7

CAS 208994-00-7 is the registry number for Thieno(2,3-b)pyrazine-6-carboxylic acid, 7-amino-2-chloro-, ethyl ester, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Ethyl 7-amino-2-chlorothieno[2,3-b]pyrazine-6-carboxylate (CAS 208994-00-7) is a chemical compound with the molecular formula C9H8ClN3O2S and a molecular weight of 257.70 g/mol. IUPAC name: ethyl 7-amino-2-chlorothieno[2,3-b]pyrazine-6-carboxylate. InChIKey: GOVBQTQQLRNYKG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClN3O2S
Molecular weight257.70 g/mol
IUPAC nameethyl 7-amino-2-chlorothieno[2,3-b]pyrazine-6-carboxylate
InChIKeyGOVBQTQQLRNYKG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C2=NC(=CN=C2S1)Cl)N

Computed by PubChem (NCBI)