CAS 208994-00-7 is the registry number for Thieno(2,3-b)pyrazine-6-carboxylic acid, 7-amino-2-chloro-, ethyl ester, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 7-amino-2-chlorothieno[2,3-b]pyrazine-6-carboxylate (CAS 208994-00-7) is a chemical compound with the molecular formula C9H8ClN3O2S and a molecular weight of 257.70 g/mol. IUPAC name: ethyl 7-amino-2-chlorothieno[2,3-b]pyrazine-6-carboxylate. InChIKey: GOVBQTQQLRNYKG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2S |
|---|---|
| Molecular weight | 257.70 g/mol |
| IUPAC name | ethyl 7-amino-2-chlorothieno[2,3-b]pyrazine-6-carboxylate |
| InChIKey | GOVBQTQQLRNYKG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=NC(=CN=C2S1)Cl)N |
Computed by PubChem (NCBI)