CAS 68342-62-1 is the registry number for 2-((4-Chlorophenyl)sulfonyl)-3-hydrazinoprop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 5000mg.
(E)-2-(4-chlorophenyl)sulfonyl-3-hydrazinylprop-2-enenitrile (CAS 68342-62-1) is a chemical compound with the molecular formula C9H8ClN3O2S and a molecular weight of 257.70 g/mol. IUPAC name: (E)-2-(4-chlorophenyl)sulfonyl-3-hydrazinylprop-2-enenitrile. InChIKey: WHBWKRCZOFCUPG-RMKNXTFCSA-N.
| Molecular formula | C9H8ClN3O2S |
|---|---|
| Molecular weight | 257.70 g/mol |
| IUPAC name | (E)-2-(4-chlorophenyl)sulfonyl-3-hydrazinylprop-2-enenitrile |
| InChIKey | WHBWKRCZOFCUPG-RMKNXTFCSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)/C(=C/NN)/C#N)Cl |
Computed by PubChem (NCBI)