CAS 1252018-54-4 is the registry number for Ramelteon Impurity 1 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
2-(7,8-dihydro-6H-cyclopenta[e][1]benzofuran-8-yl)ethanamine;hydrochloride (CAS 1252018-54-4) is a chemical compound with the molecular formula C13H16ClNO and a molecular weight of 237.72 g/mol. IUPAC name: 2-(7,8-dihydro-6H-cyclopenta[e][1]benzofuran-8-yl)ethanamine;hydrochloride. InChIKey: GYSZCVAGFSZWRX-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | 2-(7,8-dihydro-6H-cyclopenta[e][1]benzofuran-8-yl)ethanamine;hydrochloride |
| InChIKey | GYSZCVAGFSZWRX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1CCN)C3=C(C=C2)OC=C3.Cl |
Computed by PubChem (NCBI)