Products 125240-02-0
CAS 125240-02-0 appears in our catalog under these names: 4'-Methoxy-5,6-benzoflavone, 95%, 4'-Methoxy-5,6-benzoflavone, >95% (HPLC), 4'-Methoxy-5,6-benzoflavone. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 25g, 5g, 2,5g, 250mg, 500mg, 10g.
3-(4-methoxyphenyl)benzo[f]chromen-1-one (CAS 125240-02-0) is a chemical compound with the molecular formula C20H14O3 and a molecular weight of 302.3 g/mol. IUPAC name: 3-(4-methoxyphenyl)benzo[f]chromen-1-one. InChIKey: LNVFIVSNGPLFPU-UHFFFAOYSA-N.
| Molecular formula | C20H14O3 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)benzo[f]chromen-1-one |
| InChIKey | LNVFIVSNGPLFPU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)