CAS 206121-32-6 appears in our catalog under these names: Beta-2'-methoxynaphthoflavone, 95%, beta-2'-Methoxynaphthoflavone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
3-(2-methoxyphenyl)benzo[f]chromen-1-one (CAS 206121-32-6) is a chemical compound with the molecular formula C20H14O3 and a molecular weight of 302.3 g/mol. IUPAC name: 3-(2-methoxyphenyl)benzo[f]chromen-1-one. InChIKey: PCTZJHHURYBJOH-UHFFFAOYSA-N.
| Molecular formula | C20H14O3 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 3-(2-methoxyphenyl)benzo[f]chromen-1-one |
| InChIKey | PCTZJHHURYBJOH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC(=O)C3=C(O2)C=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)