Products 300826-39-5
CAS 300826-39-5 is the registry number for 3-(Benzyloxy)-6H-benzo(c)chromen-6-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
3-phenylmethoxybenzo[c]chromen-6-one (CAS 300826-39-5) is a chemical compound with the molecular formula C20H14O3 and a molecular weight of 302.3 g/mol. IUPAC name: 3-phenylmethoxybenzo[c]chromen-6-one. InChIKey: VABIAROAZJNLBQ-UHFFFAOYSA-N.
| Molecular formula | C20H14O3 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 3-phenylmethoxybenzo[c]chromen-6-one |
| InChIKey | VABIAROAZJNLBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C4=CC=CC=C4C(=O)O3 |
Computed by PubChem (NCBI)