CAS 303058-49-3 is the registry number for 4-Formylphenyl [1,1'-biphenyl]-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-formylphenyl) 4-phenylbenzoate (CAS 303058-49-3) is a chemical compound with the molecular formula C20H14O3 and a molecular weight of 302.3 g/mol. IUPAC name: (4-formylphenyl) 4-phenylbenzoate. InChIKey: MSJNUNCHBHLTMZ-UHFFFAOYSA-N.
| Molecular formula | C20H14O3 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | (4-formylphenyl) 4-phenylbenzoate |
| InChIKey | MSJNUNCHBHLTMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)