CAS 1252598-02-9 is the registry number for Indazole-4-boronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1H-indazol-4-ylboronic acid;hydrochloride (CAS 1252598-02-9) is a chemical compound with the molecular formula C7H8BClN2O2 and a molecular weight of 198.42 g/mol. IUPAC name: 1H-indazol-4-ylboronic acid;hydrochloride. InChIKey: PAILGUQNESDYLX-UHFFFAOYSA-N.
| Molecular formula | C7H8BClN2O2 |
|---|---|
| Molecular weight | 198.42 g/mol |
| IUPAC name | 1H-indazol-4-ylboronic acid;hydrochloride |
| InChIKey | PAILGUQNESDYLX-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=NNC2=CC=C1)(O)O.Cl |
Computed by PubChem (NCBI)