CAS 850568-47-7 appears in our catalog under these names: 2-Amino-4-cyanophenylboronic acid hydrochloride, 98%, (2-Amino-4-cyanophenyl)boronic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2-amino-4-cyanophenyl)boronic acid;hydrochloride (CAS 850568-47-7) is a chemical compound with the molecular formula C7H8BClN2O2 and a molecular weight of 198.42 g/mol. IUPAC name: (2-amino-4-cyanophenyl)boronic acid;hydrochloride. InChIKey: XTCOKKVEUFHXBE-UHFFFAOYSA-N.
| Molecular formula | C7H8BClN2O2 |
|---|---|
| Molecular weight | 198.42 g/mol |
| IUPAC name | (2-amino-4-cyanophenyl)boronic acid;hydrochloride |
| InChIKey | XTCOKKVEUFHXBE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C#N)N)(O)O.Cl |
Computed by PubChem (NCBI)