Products 1257738-46-7

CAS 1257738-46-7 is the registry number for Indazole-5-boronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1H-indazol-5-ylboronic acid;hydrochloride (CAS 1257738-46-7) is a chemical compound with the molecular formula C7H8BClN2O2 and a molecular weight of 198.42 g/mol. IUPAC name: 1H-indazol-5-ylboronic acid;hydrochloride. InChIKey: DQTQZKIAQNCGLW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BClN2O2
Molecular weight198.42 g/mol
IUPAC name1H-indazol-5-ylboronic acid;hydrochloride
InChIKeyDQTQZKIAQNCGLW-UHFFFAOYSA-N
SMILESB(C1=CC2=C(C=C1)NN=C2)(O)O.Cl

Computed by PubChem (NCBI)