CAS 1257738-46-7 is the registry number for Indazole-5-boronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1H-indazol-5-ylboronic acid;hydrochloride (CAS 1257738-46-7) is a chemical compound with the molecular formula C7H8BClN2O2 and a molecular weight of 198.42 g/mol. IUPAC name: 1H-indazol-5-ylboronic acid;hydrochloride. InChIKey: DQTQZKIAQNCGLW-UHFFFAOYSA-N.
| Molecular formula | C7H8BClN2O2 |
|---|---|
| Molecular weight | 198.42 g/mol |
| IUPAC name | 1H-indazol-5-ylboronic acid;hydrochloride |
| InChIKey | DQTQZKIAQNCGLW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NN=C2)(O)O.Cl |
Computed by PubChem (NCBI)