CAS 2377610-26-7 is the registry number for Imidazo[1,2-a]pyridine-6-boronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Imidazo[1,2-a]pyridin-6-ylboronic acid;hydrochloride (CAS 2377610-26-7) is a chemical compound with the molecular formula C7H8BClN2O2 and a molecular weight of 198.42 g/mol. IUPAC name: imidazo[1,2-a]pyridin-6-ylboronic acid;hydrochloride. InChIKey: IHKGNVOZYFJQIG-UHFFFAOYSA-N.
| Molecular formula | C7H8BClN2O2 |
|---|---|
| Molecular weight | 198.42 g/mol |
| IUPAC name | imidazo[1,2-a]pyridin-6-ylboronic acid;hydrochloride |
| InChIKey | IHKGNVOZYFJQIG-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C=CN=C2C=C1)(O)O.Cl |
Computed by PubChem (NCBI)