CAS 1252900-85-8 appears in our catalog under these names: 5-Chloro-4-cyclopropylthiophene-2-carboxylic acid, 95%, 5–Chloro–4–cyclopropylthiophene–2–carboxylic acid, 5-Chloro-4-cyclopropylthiophene-2-carboxylic acid 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-chloro-4-cyclopropylthiophene-2-carboxylic acid (CAS 1252900-85-8) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: 5-chloro-4-cyclopropylthiophene-2-carboxylic acid. InChIKey: GLJZZDMCKDFNNF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO2S |
|---|---|
| Molecular weight | 202.66 g/mol |
| IUPAC name | 5-chloro-4-cyclopropylthiophene-2-carboxylic acid |
| InChIKey | GLJZZDMCKDFNNF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(SC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)