Products 166811-60-5

CAS 166811-60-5 is the registry number for 4-Chloro-3-(methylthio)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-3-methylsulfanylbenzoic acid (CAS 166811-60-5) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: 4-chloro-3-methylsulfanylbenzoic acid. InChIKey: RTEJAGIAENPNEE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO2S
Molecular weight202.66 g/mol
IUPAC name4-chloro-3-methylsulfanylbenzoic acid
InChIKeyRTEJAGIAENPNEE-UHFFFAOYSA-N
SMILESCSC1=C(C=CC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)