Products 53985-46-9
CAS 53985-46-9 appears in our catalog under these names: 3-Chloro-5-(methylthio)benzoic acid, 95%, 3-Chloro-5-(methylthio)benzoic acid, 97%, 3-Chloro-5-(methylsulfanyl)benzoic acid, 3-Chloro-5-(methylthio)benzoic acid, ≥95%, ≥95%, 3-Chloro-5-(methylthio)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 0,5g.
3-chloro-5-methylsulfanylbenzoic acid (CAS 53985-46-9) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: 3-chloro-5-methylsulfanylbenzoic acid. InChIKey: NHMAJWOUAWHETL-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO2S |
|---|---|
| Molecular weight | 202.66 g/mol |
| IUPAC name | 3-chloro-5-methylsulfanylbenzoic acid |
| InChIKey | NHMAJWOUAWHETL-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)