CAS 2633-67-2 appears in our catalog under these names: 4-Styrenesulfonyl chloride, 95%, 4-Vinylbenzenesulfonyl chloride, 95% mix TBC as stabilizer, 4-Ethenylbenzene-1-sulfonyl chloride, 4-Ethenylbenzenesulfonyl Chloride, >95%, >95%, 4-Vinylbenzenesulfonyl chloride, >95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 0,5g, 10g, 25g.
4-ethenylbenzenesulfonyl chloride (CAS 2633-67-2) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: 4-ethenylbenzenesulfonyl chloride. InChIKey: VHEKFTULOYIMSU-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO2S |
|---|---|
| Molecular weight | 202.66 g/mol |
| IUPAC name | 4-ethenylbenzenesulfonyl chloride |
| InChIKey | VHEKFTULOYIMSU-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)