CAS 1253200-91-7 appears in our catalog under these names: (3R,6R)-1-(tert-Butoxycarbonyl)-6-methylpiperidine-3-carboxylic acid, 97%, (3R,6R)-1-(tert-Butoxycarbonyl)-6-methylpiperidine-3-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
(3R,6R)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1253200-91-7) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3R,6R)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: TZCMQIKRCZLVQN-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3R,6R)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | TZCMQIKRCZLVQN-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)