CAS 1253200-92-8 appears in our catalog under these names: (3S,6R)-1-[(tert-Butoxy)carbonyl]-6-methylpiperidine-3-carboxylic acid, 95%, (3S,6R)-1-((tert-Butoxy)carbonyl)-6-methylpiperidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
(3S,6R)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1253200-92-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3S,6R)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: TZCMQIKRCZLVQN-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3S,6R)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | TZCMQIKRCZLVQN-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CC[C@@H](CN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)