CAS 924021-70-5 is the registry number for 4-(5-(4-Methylphenyl)-1H-1,2,3-triazol-1-yl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[5-(4-methylphenyl)triazol-1-yl]benzoic acid (CAS 924021-70-5) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: 4-[5-(4-methylphenyl)triazol-1-yl]benzoic acid. InChIKey: FZELXMVKZXAOKK-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 4-[5-(4-methylphenyl)triazol-1-yl]benzoic acid |
| InChIKey | FZELXMVKZXAOKK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN=NN2C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)